C8H13NO2 — CID 57434337
(2S)-2-tert-butyl-3-hydroxy-1,2-dihydropyrrol-5-one (PubChem CID 57434337) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (2S)-2-tert-butyl-3-hydroxy-1,2-dihydropyrrol-5-one.
| Compound Name | (2S)-2-tert-butyl-3-hydroxy-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 57434337 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (2S)-2-tert-butyl-3-hydroxy-1,2-dihydropyrrol-5-one |
| SMILES | CC(C)(C)[C@@H]1NC(=O)C=C1O |
| InChI | InChI=1S/C8H13NO2/c1-8(2,3)7-5(10)4-6(11)9-7/h4,7,10H,1-3H3,(H,9,11)/t7-/m1/s1 |
| InChIKey | GERQFAWDZLJNDI-SSDOTTSWSA-N |
| XLogP | 0.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |