About 4-hydroxy-2,3-dimethyl-2,3-dihydro-1H-pyridin-6-one
4-hydroxy-2,3-dimethyl-2,3-dihydro-1H-pyridin-6-one (PubChem CID 59936977) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 4-hydroxy-2,3-dimethyl-2,3-dihydro-1H-pyridin-6-one.
Analyze 4-hydroxy-2,3-dimethyl-2,3-dihydro-1H-pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,3-dimethyl-2,3-dihydro-1H-pyridin-6-one?
The IUPAC name of 4-hydroxy-2,3-dimethyl-2,3-dihydro-1H-pyridin-6-one (CID 59936977) is 4-hydroxy-2,3-dimethyl-2,3-dihydro-1H-pyridin-6-one.
What is the SMILES notation for 4-hydroxy-2,3-dimethyl-2,3-dihydro-1H-pyridin-6-one?
The canonical SMILES for 4-hydroxy-2,3-dimethyl-2,3-dihydro-1H-pyridin-6-one is CC1NC(=O)C=C(O)C1C.
What is the InChIKey of 4-hydroxy-2,3-dimethyl-2,3-dihydro-1H-pyridin-6-one?
The InChIKey is YTBNGZLIAVIFGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-4-5(2)8-7(10)3-6(4)9/h3-5,9H,1-2H3,(H,8,10).
What are the key properties of 4-hydroxy-2,3-dimethyl-2,3-dihydro-1H-pyridin-6-one?
4-hydroxy-2,3-dimethyl-2,3-dihydro-1H-pyridin-6-one has a molecular weight of 141.17 g/mol, XLogP of 0.58, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,3-dimethyl-2,3-dihydro-1H-pyridin-6-one is sourced from PubChem (CID 59936977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).