C21H18ClFN6O4 — CID 57438605
(2R)-2-[1-(2-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]oxy-N-(5-fluoro-2-pyridinyl)-3-(2-hydroxyethoxy)propanamide (PubChem CID 57438605) has the molecular formula C21H18ClFN6O4 and a molecular weight of 472.86 g/mol. Its IUPAC name is (2R)-2-[1-(2-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]oxy-N-(5-fluoro-2-pyridinyl)-3-(2-hydroxyethoxy)propanamide.
| Compound Name | (2R)-2-[1-(2-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]oxy-N-(5-fluoro-2-pyridinyl)-3-(2-hydroxyethoxy)propanamide |
|---|---|
| PubChem CID | 57438605 |
| Molecular Formula | C21H18ClFN6O4 |
| Molecular Weight | 472.86 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | (2R)-2-[1-(2-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]oxy-N-(5-fluoro-2-pyridinyl)-3-(2-hydroxyethoxy)propanamide |
| SMILES | O=C(Nc1ccc(F)cn1)[C@@H](COCCO)Oc1ncnc2c1cnn2-c1ccccc1Cl |
| InChI | InChI=1S/C21H18ClFN6O4/c22-15-3-1-2-4-16(15)29-19-14(10-27-29)21(26-12-25-19)33-17(11-32-8-7-30)20(31)28-18-6-5-13(23)9-24-18/h1-6,9-10,12,17,30H,7-8,11H2,(H,24,28,31)/t17-/m1/s1 |
| InChIKey | VPDZTPHDUAHHPV-QGZVFWFLSA-N |
| XLogP | 2.40 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.86 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|