C12H14N2O — CID 57440520
N-prop-2-enyl-2,3-dihydro-1H-isoindole-1-carboxamide (PubChem CID 57440520) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is N-prop-2-enyl-2,3-dihydro-1H-isoindole-1-carboxamide.
| Compound Name | N-prop-2-enyl-2,3-dihydro-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 57440520 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | N-prop-2-enyl-2,3-dihydro-1H-isoindole-1-carboxamide |
| SMILES | C=CCNC(=O)C1NCc2ccccc21 |
| InChI | InChI=1S/C12H14N2O/c1-2-7-13-12(15)11-10-6-4-3-5-9(10)8-14-11/h2-6,11,14H,1,7-8H2,(H,13,15) |
| InChIKey | DAAPXVQRLWHNMD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|