C23H26ClNO7 — CID 57440531
3-[1-[5-chloro-2,4-bis(methoxymethoxy)benzoyl]pyrrolidin-2-yl]-2-methylbenzoic acid (PubChem CID 57440531) has the molecular formula C23H26ClNO7 and a molecular weight of 463.91 g/mol. Its IUPAC name is 3-[1-[5-chloro-2,4-bis(methoxymethoxy)benzoyl]pyrrolidin-2-yl]-2-methylbenzoic acid.
| Compound Name | 3-[1-[5-chloro-2,4-bis(methoxymethoxy)benzoyl]pyrrolidin-2-yl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 57440531 |
| Molecular Formula | C23H26ClNO7 |
| Molecular Weight | 463.91 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 3-[1-[5-chloro-2,4-bis(methoxymethoxy)benzoyl]pyrrolidin-2-yl]-2-methylbenzoic acid |
| SMILES | COCOc1cc(OCOC)c(C(=O)N2CCCC2c2cccc(C(=O)O)c2C)cc1Cl |
| InChI | InChI=1S/C23H26ClNO7/c1-14-15(6-4-7-16(14)23(27)28)19-8-5-9-25(19)22(26)17-10-18(24)21(32-13-30-3)11-20(17)31-12-29-2/h4,6-7,10-11,19H,5,8-9,12-13H2,1-3H3,(H,27,28) |
| InChIKey | AUUUTCWSBCEPMO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.91 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|