C20H22INO3 — CID 55685739
[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-(2-iodo-3-methylphenyl)methanone (PubChem CID 55685739) has the molecular formula C20H22INO3 and a molecular weight of 451.30 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-(2-iodo-3-methylphenyl)methanone.
| Compound Name | [2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-(2-iodo-3-methylphenyl)methanone |
|---|---|
| PubChem CID | 55685739 |
| Molecular Formula | C20H22INO3 |
| Molecular Weight | 451.30 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-(2-iodo-3-methylphenyl)methanone |
| SMILES | COc1ccc(OC)c(C2CCCN2C(=O)c2cccc(C)c2I)c1 |
| InChI | InChI=1S/C20H22INO3/c1-13-6-4-7-15(19(13)21)20(23)22-11-5-8-17(22)16-12-14(24-2)9-10-18(16)25-3/h4,6-7,9-10,12,17H,5,8,11H2,1-3H3 |
| InChIKey | AGLRZTPPNJSTOI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.30 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|