About hex-1-yne-1-sulfinate
hex-1-yne-1-sulfinate (PubChem CID 57440958) has the molecular formula C6H9O2S-
and a molecular weight of 145.20 g/mol. Its IUPAC name is hex-1-yne-1-sulfinate.
Molecular Properties
| Compound Name | hex-1-yne-1-sulfinate |
| PubChem CID | 57440958 |
| Molecular Formula | C6H9O2S- |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.03 |
| IUPAC Name | hex-1-yne-1-sulfinate |
| SMILES | CCCCC#CS(=O)[O-] |
| InChI | InChI=1S/C6H10O2S/c1-2-3-4-5-6-9(7)8/h2-4H2,1H3,(H,7,8)/p-1 |
| InChIKey | RXDHBRIDCMOKIH-UHFFFAOYSA-M |
| XLogP | 1.02 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hex-1-yne-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-1-yne-1-sulfinate?
The IUPAC name of hex-1-yne-1-sulfinate (CID 57440958) is hex-1-yne-1-sulfinate.
What is the SMILES notation for hex-1-yne-1-sulfinate?
The canonical SMILES for hex-1-yne-1-sulfinate is CCCCC#CS(=O)[O-].
What is the InChIKey of hex-1-yne-1-sulfinate?
The InChIKey is RXDHBRIDCMOKIH-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H10O2S/c1-2-3-4-5-6-9(7)8/h2-4H2,1H3,(H,7,8)/p-1.
What are the key properties of hex-1-yne-1-sulfinate?
hex-1-yne-1-sulfinate has a molecular weight of 145.20 g/mol, XLogP of 1.02, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hex-1-yne-1-sulfinate is sourced from PubChem (CID 57440958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).