C23H40N4O2 — CID 57443186
N-[1-[2-(4-cyclobutylpiperazin-1-yl)-2-oxoethyl]piperidin-4-yl]-2-cyclohexylacetamide (PubChem CID 57443186) has the molecular formula C23H40N4O2 and a molecular weight of 404.60 g/mol. Its IUPAC name is N-[1-[2-(4-cyclobutylpiperazin-1-yl)-2-oxoethyl]piperidin-4-yl]-2-cyclohexylacetamide.
| Compound Name | N-[1-[2-(4-cyclobutylpiperazin-1-yl)-2-oxoethyl]piperidin-4-yl]-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 57443186 |
| Molecular Formula | C23H40N4O2 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | N-[1-[2-(4-cyclobutylpiperazin-1-yl)-2-oxoethyl]piperidin-4-yl]-2-cyclohexylacetamide |
| SMILES | O=C(CC1CCCCC1)NC1CCN(CC(=O)N2CCN(C3CCC3)CC2)CC1 |
| InChI | InChI=1S/C23H40N4O2/c28-22(17-19-5-2-1-3-6-19)24-20-9-11-25(12-10-20)18-23(29)27-15-13-26(14-16-27)21-7-4-8-21/h19-21H,1-18H2,(H,24,28) |
| InChIKey | FNAWTBALBGBBHJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |