C19H14Br3N3O — CID 57455485
6-(2-aminoethyl)-9-(3,4,5-tribromo-1H-pyrrol-2-yl)-2H-benzo[h]isoquinolin-1-one (PubChem CID 57455485) has the molecular formula C19H14Br3N3O and a molecular weight of 540.05 g/mol. Its IUPAC name is 6-(2-aminoethyl)-9-(3,4,5-tribromo-1H-pyrrol-2-yl)-2H-benzo[h]isoquinolin-1-one.
| Compound Name | 6-(2-aminoethyl)-9-(3,4,5-tribromo-1H-pyrrol-2-yl)-2H-benzo[h]isoquinolin-1-one |
|---|---|
| PubChem CID | 57455485 |
| Molecular Formula | C19H14Br3N3O |
| Molecular Weight | 540.05 g/mol |
| Exact Mass | 536.87 |
| IUPAC Name | 6-(2-aminoethyl)-9-(3,4,5-tribromo-1H-pyrrol-2-yl)-2H-benzo[h]isoquinolin-1-one |
| SMILES | NCCc1cc2cc[nH]c(=O)c2c2cc(-c3[nH]c(Br)c(Br)c3Br)ccc12 |
| InChI | InChI=1S/C19H14Br3N3O/c20-15-16(21)18(22)25-17(15)11-1-2-12-9(3-5-23)7-10-4-6-24-19(26)14(10)13(12)8-11/h1-2,4,6-8,25H,3,5,23H2,(H,24,26) |
| InChIKey | JRDCQBMRUBJCMP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.05 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|