C26H21F3N4O — CID 57455487
6-(3-aminopropyl)-9-(1H-pyrazol-4-yl)-4-[4-(trifluoromethyl)phenyl]-2H-benzo[h]isoquinolin-1-one (PubChem CID 57455487) has the molecular formula C26H21F3N4O and a molecular weight of 462.48 g/mol. Its IUPAC name is 6-(3-aminopropyl)-9-(1H-pyrazol-4-yl)-4-[4-(trifluoromethyl)phenyl]-2H-benzo[h]isoquinolin-1-one.
| Compound Name | 6-(3-aminopropyl)-9-(1H-pyrazol-4-yl)-4-[4-(trifluoromethyl)phenyl]-2H-benzo[h]isoquinolin-1-one |
|---|---|
| PubChem CID | 57455487 |
| Molecular Formula | C26H21F3N4O |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 6-(3-aminopropyl)-9-(1H-pyrazol-4-yl)-4-[4-(trifluoromethyl)phenyl]-2H-benzo[h]isoquinolin-1-one |
| SMILES | NCCCc1cc2c(-c3ccc(C(F)(F)F)cc3)c[nH]c(=O)c2c2cc(-c3cn[nH]c3)ccc12 |
| InChI | InChI=1S/C26H21F3N4O/c27-26(28,29)19-6-3-15(4-7-19)23-14-31-25(34)24-21-10-16(18-12-32-33-13-18)5-8-20(21)17(2-1-9-30)11-22(23)24/h3-8,10-14H,1-2,9,30H2,(H,31,34)(H,32,33) |
| InChIKey | ODGUJGLXTHXRCW-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|