C19H19BrN4O — CID 143393382
9-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-6-(3-aminopropyl)-4-bromo-2H-benzo[h]isoquinolin-1-one (PubChem CID 143393382) has the molecular formula C19H19BrN4O and a molecular weight of 399.29 g/mol. Its IUPAC name is 9-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-6-(3-aminopropyl)-4-bromo-2H-benzo[h]isoquinolin-1-one.
| Compound Name | 9-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-6-(3-aminopropyl)-4-bromo-2H-benzo[h]isoquinolin-1-one |
|---|---|
| PubChem CID | 143393382 |
| Molecular Formula | C19H19BrN4O |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 9-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-6-(3-aminopropyl)-4-bromo-2H-benzo[h]isoquinolin-1-one |
| SMILES | [H]/N=C/C(=C\N)c1ccc2c(CCCN)cc3c(Br)c[nH]c(=O)c3c2c1 |
| InChI | InChI=1S/C19H19BrN4O/c20-17-10-24-19(25)18-15-6-11(13(8-22)9-23)3-4-14(15)12(2-1-5-21)7-16(17)18/h3-4,6-10,22H,1-2,5,21,23H2,(H,24,25)/b13-9+,22-8+ |
| InChIKey | HNUIJOCZTJONLJ-YYSWOKLVSA-N |
| XLogP | 3.28 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|