C25H23N3O4 — CID 57455575
9-[3-[2-(dimethylamino)ethylcarbamoyl]phenyl]-1-oxo-2H-benzo[h]isoquinoline-6-carboxylic acid (PubChem CID 57455575) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is 9-[3-[2-(dimethylamino)ethylcarbamoyl]phenyl]-1-oxo-2H-benzo[h]isoquinoline-6-carboxylic acid.
| Compound Name | 9-[3-[2-(dimethylamino)ethylcarbamoyl]phenyl]-1-oxo-2H-benzo[h]isoquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 57455575 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 9-[3-[2-(dimethylamino)ethylcarbamoyl]phenyl]-1-oxo-2H-benzo[h]isoquinoline-6-carboxylic acid |
| SMILES | CN(C)CCNC(=O)c1cccc(-c2ccc3c(C(=O)O)cc4cc[nH]c(=O)c4c3c2)c1 |
| InChI | InChI=1S/C25H23N3O4/c1-28(2)11-10-27-23(29)18-5-3-4-15(12-18)16-6-7-19-20(13-16)22-17(8-9-26-24(22)30)14-21(19)25(31)32/h3-9,12-14H,10-11H2,1-2H3,(H,26,30)(H,27,29)(H,31,32) |
| InChIKey | ZCQGHUFYCMYKFG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|