C20H19ClF4N4O — CID 57459499
8-chloro-7-[4-(2-fluoro-6-methoxyphenyl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 57459499) has the molecular formula C20H19ClF4N4O and a molecular weight of 442.84 g/mol. Its IUPAC name is 8-chloro-7-[4-(2-fluoro-6-methoxyphenyl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 8-chloro-7-[4-(2-fluoro-6-methoxyphenyl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 57459499 |
| Molecular Formula | C20H19ClF4N4O |
| Molecular Weight | 442.84 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 8-chloro-7-[4-(2-fluoro-6-methoxyphenyl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | COc1cccc(F)c1C1CCN(c2ccn3c(CC(F)(F)F)nnc3c2Cl)CC1 |
| InChI | InChI=1S/C20H19ClF4N4O/c1-30-15-4-2-3-13(22)17(15)12-5-8-28(9-6-12)14-7-10-29-16(11-20(23,24)25)26-27-19(29)18(14)21/h2-4,7,10,12H,5-6,8-9,11H2,1H3 |
| InChIKey | AUVJPLIAAMTDRB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.84 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |