C9H14N2O2 — CID 57463673
cis-(1R,2S)-2-(aziridine-1-carbonyl)cyclopentane-1-carboxamide (PubChem CID 57463673) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is cis-(1R,2S)-2-(aziridine-1-carbonyl)cyclopentane-1-carboxamide.
| Compound Name | cis-(1R,2S)-2-(aziridine-1-carbonyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 57463673 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | cis-(1R,2S)-2-(aziridine-1-carbonyl)cyclopentane-1-carboxamide |
| SMILES | NC(=O)[C@@H]1CCC[C@@H]1C(=O)N1CC1 |
| InChI | InChI=1S/C9H14N2O2/c10-8(12)6-2-1-3-7(6)9(13)11-4-5-11/h6-7H,1-5H2,(H2,10,12)/t6-,7+/m1/s1 |
| InChIKey | BEKXTZJKPZMXGL-RQJHMYQMSA-N |
| XLogP | -0.27 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|