C10H12O6 — CID 57465820
2-[4-(carboxymethyl)-1,4-dihydroxycyclohexa-2,5-dien-1-yl]acetic acid (PubChem CID 57465820) has the molecular formula C10H12O6 and a molecular weight of 228.20 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)-1,4-dihydroxycyclohexa-2,5-dien-1-yl]acetic acid.
| Compound Name | 2-[4-(carboxymethyl)-1,4-dihydroxycyclohexa-2,5-dien-1-yl]acetic acid |
|---|---|
| PubChem CID | 57465820 |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 2-[4-(carboxymethyl)-1,4-dihydroxycyclohexa-2,5-dien-1-yl]acetic acid |
| SMILES | O=C(O)CC1(O)C=CC(O)(CC(=O)O)C=C1 |
| InChI | InChI=1S/C10H12O6/c11-7(12)5-9(15)1-2-10(16,4-3-9)6-8(13)14/h1-4,15-16H,5-6H2,(H,11,12)(H,13,14) |
| InChIKey | IDTKYTWQXXMCNW-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|