C23H31N6O3+ — CID 57467854
2-[6-amino-4-imino-3-[2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-1,5-dien-1-yl]oxyethanol (PubChem CID 57467854) has the molecular formula C23H31N6O3+ and a molecular weight of 439.54 g/mol. Its IUPAC name is 2-[6-amino-4-imino-3-[2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-1,5-dien-1-yl]oxyethanol.
| Compound Name | 2-[6-amino-4-imino-3-[2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-1,5-dien-1-yl]oxyethanol |
|---|---|
| PubChem CID | 57467854 |
| Molecular Formula | C23H31N6O3+ |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 2-[6-amino-4-imino-3-[2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-1,5-dien-1-yl]oxyethanol |
| SMILES | [H]/N=C1\C=C(N)C(OCCO)=C\C1=N/c1c(OCC[N+]2(C)CCCCC2)nn2ccccc12 |
| InChI | InChI=1S/C23H31N6O3/c1-29(9-5-2-6-10-29)11-13-32-23-22(20-7-3-4-8-28(20)27-23)26-19-16-21(31-14-12-30)18(25)15-17(19)24/h3-4,7-8,15-16,24,30H,2,5-6,9-14,25H2,1H3/q+1/b24-17+,26-19+ |
| InChIKey | SYGFUYTXBGBVPM-OTYWJGQRSA-N |
| XLogP | 2.18 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|