C23H17F3N2O2S2 — CID 57469021
5-[3-[4-methyl-6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]phenyl]thiophene-2-sulfonamide (PubChem CID 57469021) has the molecular formula C23H17F3N2O2S2 and a molecular weight of 474.53 g/mol. Its IUPAC name is 5-[3-[4-methyl-6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-[3-[4-methyl-6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 57469021 |
| Molecular Formula | C23H17F3N2O2S2 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 5-[3-[4-methyl-6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]phenyl]thiophene-2-sulfonamide |
| SMILES | Cc1cc(-c2ccc(C(F)(F)F)cc2)nc(-c2cccc(-c3ccc(S(N)(=O)=O)s3)c2)c1 |
| InChI | InChI=1S/C23H17F3N2O2S2/c1-14-11-19(15-5-7-18(8-6-15)23(24,25)26)28-20(12-14)16-3-2-4-17(13-16)21-9-10-22(31-21)32(27,29)30/h2-13H,1H3,(H2,27,29,30) |
| InChIKey | ZXNASIMPWQZUQJ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |