C16H19NO4 — CID 57469667
tert-butyl 2-(2-formylcyclohexa-1,3-dien-1-yl)-1,4-oxazine-4-carboxylate (PubChem CID 57469667) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is tert-butyl 2-(2-formylcyclohexa-1,3-dien-1-yl)-1,4-oxazine-4-carboxylate.
| Compound Name | tert-butyl 2-(2-formylcyclohexa-1,3-dien-1-yl)-1,4-oxazine-4-carboxylate |
|---|---|
| PubChem CID | 57469667 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | tert-butyl 2-(2-formylcyclohexa-1,3-dien-1-yl)-1,4-oxazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=COC(C2=C(C=O)C=CCC2)=C1 |
| InChI | InChI=1S/C16H19NO4/c1-16(2,3)21-15(19)17-8-9-20-14(10-17)13-7-5-4-6-12(13)11-18/h4,6,8-11H,5,7H2,1-3H3 |
| InChIKey | BAGKKGRQRRWDFJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|