C24H31ClN2O2S — CID 57471459
N-[3-[7-amino-8-[(3-chlorophenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]propyl]-1-cyclopropylmethanesulfonamide (PubChem CID 57471459) has the molecular formula C24H31ClN2O2S and a molecular weight of 447.04 g/mol. Its IUPAC name is N-[3-[7-amino-8-[(3-chlorophenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]propyl]-1-cyclopropylmethanesulfonamide.
| Compound Name | N-[3-[7-amino-8-[(3-chlorophenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]propyl]-1-cyclopropylmethanesulfonamide |
|---|---|
| PubChem CID | 57471459 |
| Molecular Formula | C24H31ClN2O2S |
| Molecular Weight | 447.04 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-[3-[7-amino-8-[(3-chlorophenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]propyl]-1-cyclopropylmethanesulfonamide |
| SMILES | NC1CCc2ccc(CCCNS(=O)(=O)CC3CC3)cc2C1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H31ClN2O2S/c25-21-5-1-3-19(13-21)15-23-22-14-17(8-9-20(22)10-11-24(23)26)4-2-12-27-30(28,29)16-18-6-7-18/h1,3,5,8-9,13-14,18,23-24,27H,2,4,6-7,10-12,15-16,26H2 |
| InChIKey | SZVZDVDVQWZJRP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.04 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|