C17H14Cl2F3N3O3S — CID 57473995
2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-(7-hydroxy-1H-indol-3-yl)propan-2-yl]benzenesulfonamide (PubChem CID 57473995) has the molecular formula C17H14Cl2F3N3O3S and a molecular weight of 468.28 g/mol. Its IUPAC name is 2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-(7-hydroxy-1H-indol-3-yl)propan-2-yl]benzenesulfonamide.
| Compound Name | 2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-(7-hydroxy-1H-indol-3-yl)propan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 57473995 |
| Molecular Formula | C17H14Cl2F3N3O3S |
| Molecular Weight | 468.28 g/mol |
| Exact Mass | 467.01 |
| IUPAC Name | 2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-(7-hydroxy-1H-indol-3-yl)propan-2-yl]benzenesulfonamide |
| SMILES | Nc1cc(Cl)cc(Cl)c1S(=O)(=O)NC(Cc1c[nH]c2c(O)cccc12)C(F)(F)F |
| InChI | InChI=1S/C17H14Cl2F3N3O3S/c18-9-5-11(19)16(12(23)6-9)29(27,28)25-14(17(20,21)22)4-8-7-24-15-10(8)2-1-3-13(15)26/h1-3,5-7,14,24-26H,4,23H2 |
| InChIKey | DUBWGSHHMMHFLE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|