C21H14Cl2F4N4O2S — CID 24960192
2-amino-4,6-dichloro-N-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethyl]benzenesulfonamide (PubChem CID 24960192) has the molecular formula C21H14Cl2F4N4O2S and a molecular weight of 533.33 g/mol. Its IUPAC name is 2-amino-4,6-dichloro-N-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethyl]benzenesulfonamide.
| Compound Name | 2-amino-4,6-dichloro-N-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24960192 |
| Molecular Formula | C21H14Cl2F4N4O2S |
| Molecular Weight | 533.33 g/mol |
| Exact Mass | 532.02 |
| IUPAC Name | 2-amino-4,6-dichloro-N-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethyl]benzenesulfonamide |
| SMILES | Nc1cc(Cl)cc(Cl)c1S(=O)(=O)NC(c1ccc2c(cnn2-c2ccc(F)cc2)c1)C(F)(F)F |
| InChI | InChI=1S/C21H14Cl2F4N4O2S/c22-13-8-16(23)19(17(28)9-13)34(32,33)30-20(21(25,26)27)11-1-6-18-12(7-11)10-29-31(18)15-4-2-14(24)3-5-15/h1-10,20,30H,28H2 |
| InChIKey | FGMQCFCUFFKWDW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.33 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|