C23H22Cl2FN5O2S — CID 68571448
2-amino-4,6-dichloro-N-[1-[[1-(4-fluorophenyl)indazol-5-yl]amino]butan-2-yl]benzenesulfonamide (PubChem CID 68571448) has the molecular formula C23H22Cl2FN5O2S and a molecular weight of 522.43 g/mol. Its IUPAC name is 2-amino-4,6-dichloro-N-[1-[[1-(4-fluorophenyl)indazol-5-yl]amino]butan-2-yl]benzenesulfonamide.
| Compound Name | 2-amino-4,6-dichloro-N-[1-[[1-(4-fluorophenyl)indazol-5-yl]amino]butan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 68571448 |
| Molecular Formula | C23H22Cl2FN5O2S |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | 2-amino-4,6-dichloro-N-[1-[[1-(4-fluorophenyl)indazol-5-yl]amino]butan-2-yl]benzenesulfonamide |
| SMILES | CCC(CNc1ccc2c(cnn2-c2ccc(F)cc2)c1)NS(=O)(=O)c1c(N)cc(Cl)cc1Cl |
| InChI | InChI=1S/C23H22Cl2FN5O2S/c1-2-17(30-34(32,33)23-20(25)10-15(24)11-21(23)27)13-28-18-5-8-22-14(9-18)12-29-31(22)19-6-3-16(26)4-7-19/h3-12,17,28,30H,2,13,27H2,1H3 |
| InChIKey | QWTYOFRWASSYAB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|