C21H27N5O3S — CID 57479972
N-[5-[[3-(1H-indazol-5-ylamino)piperidin-1-yl]methyl]-2-methoxyphenyl]methanesulfonamide (PubChem CID 57479972) has the molecular formula C21H27N5O3S and a molecular weight of 429.55 g/mol. Its IUPAC name is N-[5-[[3-(1H-indazol-5-ylamino)piperidin-1-yl]methyl]-2-methoxyphenyl]methanesulfonamide.
| Compound Name | N-[5-[[3-(1H-indazol-5-ylamino)piperidin-1-yl]methyl]-2-methoxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 57479972 |
| Molecular Formula | C21H27N5O3S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | N-[5-[[3-(1H-indazol-5-ylamino)piperidin-1-yl]methyl]-2-methoxyphenyl]methanesulfonamide |
| SMILES | COc1ccc(CN2CCCC(Nc3ccc4[nH]ncc4c3)C2)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C21H27N5O3S/c1-29-21-8-5-15(10-20(21)25-30(2,27)28)13-26-9-3-4-18(14-26)23-17-6-7-19-16(11-17)12-22-24-19/h5-8,10-12,18,23,25H,3-4,9,13-14H2,1-2H3,(H,22,24) |
| InChIKey | VZUWNZSQKXLROM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |