C13H18Cl2N2S — CID 57482543
1-(1-benzothiophen-4-yl)-2-methylpiperazine;dihydrochloride (PubChem CID 57482543) has the molecular formula C13H18Cl2N2S and a molecular weight of 305.27 g/mol. Its IUPAC name is 1-(1-benzothiophen-4-yl)-2-methylpiperazine;dihydrochloride.
| Compound Name | 1-(1-benzothiophen-4-yl)-2-methylpiperazine;dihydrochloride |
|---|---|
| PubChem CID | 57482543 |
| Molecular Formula | C13H18Cl2N2S |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 1-(1-benzothiophen-4-yl)-2-methylpiperazine;dihydrochloride |
| SMILES | CC1CNCCN1c1cccc2sccc12.Cl.Cl |
| InChI | InChI=1S/C13H16N2S.2ClH/c1-10-9-14-6-7-15(10)12-3-2-4-13-11(12)5-8-16-13;;/h2-5,8,10,14H,6-7,9H2,1H3;2*1H |
| InChIKey | NAYVEPOUFWUJRF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |