C18H24N2O2S — CID 57482542
tert-butyl 4-(1-benzothiophen-4-yl)-3-methylpiperazine-1-carboxylate (PubChem CID 57482542) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is tert-butyl 4-(1-benzothiophen-4-yl)-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(1-benzothiophen-4-yl)-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 57482542 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | tert-butyl 4-(1-benzothiophen-4-yl)-3-methylpiperazine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCN1c1cccc2sccc12 |
| InChI | InChI=1S/C18H24N2O2S/c1-13-12-19(17(21)22-18(2,3)4)9-10-20(13)15-6-5-7-16-14(15)8-11-23-16/h5-8,11,13H,9-10,12H2,1-4H3 |
| InChIKey | PEHOOXGAAWLFSC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |