C32H38F2N2O2 — CID 57487532
N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-hex-5-enylbenzamide (PubChem CID 57487532) has the molecular formula C32H38F2N2O2 and a molecular weight of 520.66 g/mol. Its IUPAC name is N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-hex-5-enylbenzamide.
| Compound Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-hex-5-enylbenzamide |
|---|---|
| PubChem CID | 57487532 |
| Molecular Formula | C32H38F2N2O2 |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-hex-5-enylbenzamide |
| SMILES | C=CCCCCc1cccc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@@H](O)CNCc2cccc(CC)c2)c1 |
| InChI | InChI=1S/C32H38F2N2O2/c1-3-5-6-7-10-24-12-9-14-27(16-24)32(38)36-30(19-26-17-28(33)20-29(34)18-26)31(37)22-35-21-25-13-8-11-23(4-2)15-25/h3,8-9,11-18,20,30-31,35,37H,1,4-7,10,19,21-22H2,2H3,(H,36,38)/t30-,31-/m0/s1 |
| InChIKey | YDXQTVGXGQZOQN-CONSDPRKSA-N |
| XLogP | 5.92 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|