C27H34F2N2O2 — CID 57487599
2-(cyclohexen-1-yl)-N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]acetamide (PubChem CID 57487599) has the molecular formula C27H34F2N2O2 and a molecular weight of 456.58 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]acetamide.
| Compound Name | 2-(cyclohexen-1-yl)-N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 57487599 |
| Molecular Formula | C27H34F2N2O2 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]acetamide |
| SMILES | CCc1cccc(CNC[C@H](O)[C@H](Cc2cc(F)cc(F)c2)NC(=O)CC2=CCCCC2)c1 |
| InChI | InChI=1S/C27H34F2N2O2/c1-2-19-9-6-10-21(11-19)17-30-18-26(32)25(14-22-12-23(28)16-24(29)13-22)31-27(33)15-20-7-4-3-5-8-20/h6-7,9-13,16,25-26,30,32H,2-5,8,14-15,17-18H2,1H3,(H,31,33)/t25-,26-/m0/s1 |
| InChIKey | SDHUXIKXGIFZHT-UIOOFZCWSA-N |
| XLogP | 4.60 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|