C28H32F2N6O2 — CID 58802332
N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetamide (PubChem CID 58802332) has the molecular formula C28H32F2N6O2 and a molecular weight of 522.60 g/mol. Its IUPAC name is N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetamide.
| Compound Name | N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetamide |
|---|---|
| PubChem CID | 58802332 |
| Molecular Formula | C28H32F2N6O2 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetamide |
| SMILES | CCc1cccc(CNC[C@H](O)[C@@H](Cc2cc(F)cc(F)c2)NC(=O)Cc2nc3nc(C)cc(C)n3n2)c1 |
| InChI | InChI=1S/C28H32F2N6O2/c1-4-19-6-5-7-20(9-19)15-31-16-25(37)24(12-21-10-22(29)13-23(30)11-21)33-27(38)14-26-34-28-32-17(2)8-18(3)36(28)35-26/h5-11,13,24-25,31,37H,4,12,14-16H2,1-3H3,(H,33,38)/t24-,25+/m1/s1 |
| InChIKey | CAYGMIXTWVXLLB-RPBOFIJWSA-N |
| XLogP | 3.00 |
| TPSA | 104.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |