C27H30F2N6O3 — CID 10239455
N-[(2R,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-(7-methyl-5-oxo-1H-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetamide (PubChem CID 10239455) has the molecular formula C27H30F2N6O3 and a molecular weight of 524.57 g/mol. Its IUPAC name is N-[(2R,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-(7-methyl-5-oxo-1H-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetamide.
| Compound Name | N-[(2R,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-(7-methyl-5-oxo-1H-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 10239455 |
| Molecular Formula | C27H30F2N6O3 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | N-[(2R,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-(7-methyl-5-oxo-1H-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)acetamide |
| SMILES | CCc1cccc(CNC[C@@H](O)[C@@H](Cc2cc(F)cc(F)c2)NC(=O)Cc2n[nH]c3nc(C)cc(=O)n23)c1 |
| InChI | InChI=1S/C27H30F2N6O3/c1-3-17-5-4-6-18(8-17)14-30-15-23(36)22(11-19-9-20(28)12-21(29)10-19)32-25(37)13-24-33-34-27-31-16(2)7-26(38)35(24)27/h4-10,12,22-23,30,36H,3,11,13-15H2,1-2H3,(H,31,34)(H,32,37)/t22-,23-/m1/s1 |
| InChIKey | LMWRCRGHOXRDMF-DHIUTWEWSA-N |
| XLogP | 1.99 |
| TPSA | 124.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |