C14H30 — CID 57493156
3-tert-butyl-4-ethyl-2,2-dimethylhexane (PubChem CID 57493156) has the molecular formula C14H30 and a molecular weight of 198.39 g/mol. Its IUPAC name is 3-tert-butyl-4-ethyl-2,2-dimethylhexane.
| Compound Name | 3-tert-butyl-4-ethyl-2,2-dimethylhexane |
|---|---|
| PubChem CID | 57493156 |
| Molecular Formula | C14H30 |
| Molecular Weight | 198.39 g/mol |
| Exact Mass | 198.23 |
| IUPAC Name | 3-tert-butyl-4-ethyl-2,2-dimethylhexane |
| SMILES | CCC(CC)C(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H30/c1-9-11(10-2)12(13(3,4)5)14(6,7)8/h11-12H,9-10H2,1-8H3 |
| InChIKey | FQNXFIXRDLGBEQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |