About dibutylazanium;hydron;sulfate
dibutylazanium;hydron;sulfate (PubChem CID 57494691) has the molecular formula C8H21NO4S
and a molecular weight of 227.33 g/mol. Its IUPAC name is dibutylazanium;hydron;sulfate.
Molecular Properties
| Compound Name | dibutylazanium;hydron;sulfate |
| PubChem CID | 57494691 |
| Molecular Formula | C8H21NO4S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | dibutylazanium;hydron;sulfate |
| SMILES | CCCC[NH2+]CCCC.O=S(=O)([O-])[O-].[H+] |
| InChI | InChI=1S/C8H19N.H2O4S/c1-3-5-7-9-8-6-4-2;1-5(2,3)4/h9H,3-8H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | WKCUMEYLYRIBCI-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze dibutylazanium;hydron;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutylazanium;hydron;sulfate?
The IUPAC name of dibutylazanium;hydron;sulfate (CID 57494691) is dibutylazanium;hydron;sulfate.
What is the SMILES notation for dibutylazanium;hydron;sulfate?
The canonical SMILES for dibutylazanium;hydron;sulfate is CCCC[NH2+]CCCC.O=S(=O)([O-])[O-].[H+].
What is the InChIKey of dibutylazanium;hydron;sulfate?
The InChIKey is WKCUMEYLYRIBCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.H2O4S/c1-3-5-7-9-8-6-4-2;1-5(2,3)4/h9H,3-8H2,1-2H3;(H2,1,2,3,4).
What are the key properties of dibutylazanium;hydron;sulfate?
dibutylazanium;hydron;sulfate has a molecular weight of 227.33 g/mol, XLogP of -0.08, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dibutylazanium;hydron;sulfate is sourced from PubChem (CID 57494691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).