C20H24F2N2O2 — CID 57495576
4-(3,4-difluorophenyl)-1-(5-hydroxy-2-adamantyl)-4-methylimidazolidin-2-one (PubChem CID 57495576) has the molecular formula C20H24F2N2O2 and a molecular weight of 362.42 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-1-(5-hydroxy-2-adamantyl)-4-methylimidazolidin-2-one.
| Compound Name | 4-(3,4-difluorophenyl)-1-(5-hydroxy-2-adamantyl)-4-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 57495576 |
| Molecular Formula | C20H24F2N2O2 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 4-(3,4-difluorophenyl)-1-(5-hydroxy-2-adamantyl)-4-methylimidazolidin-2-one |
| SMILES | CC1(c2ccc(F)c(F)c2)CN(C2C3CC4CC2CC(O)(C4)C3)C(=O)N1 |
| InChI | InChI=1S/C20H24F2N2O2/c1-19(14-2-3-15(21)16(22)6-14)10-24(18(25)23-19)17-12-4-11-5-13(17)9-20(26,7-11)8-12/h2-3,6,11-13,17,26H,4-5,7-10H2,1H3,(H,23,25) |
| InChIKey | SXPLRLZQYLWFNX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |