C21H25F3N2O2 — CID 57495585
1-(5-hydroxy-2-adamantyl)-4-methyl-4-[3-(trifluoromethyl)phenyl]imidazolidin-2-one (PubChem CID 57495585) has the molecular formula C21H25F3N2O2 and a molecular weight of 394.44 g/mol. Its IUPAC name is 1-(5-hydroxy-2-adamantyl)-4-methyl-4-[3-(trifluoromethyl)phenyl]imidazolidin-2-one.
| Compound Name | 1-(5-hydroxy-2-adamantyl)-4-methyl-4-[3-(trifluoromethyl)phenyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 57495585 |
| Molecular Formula | C21H25F3N2O2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-(5-hydroxy-2-adamantyl)-4-methyl-4-[3-(trifluoromethyl)phenyl]imidazolidin-2-one |
| SMILES | CC1(c2cccc(C(F)(F)F)c2)CN(C2C3CC4CC2CC(O)(C4)C3)C(=O)N1 |
| InChI | InChI=1S/C21H25F3N2O2/c1-19(15-3-2-4-16(7-15)21(22,23)24)11-26(18(27)25-19)17-13-5-12-6-14(17)10-20(28,8-12)9-13/h2-4,7,12-14,17,28H,5-6,8-11H2,1H3,(H,25,27) |
| InChIKey | ZWLUHSSMCZGKPZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |