C11H10F3NO — CID 64666853
4-methyl-4-[3-(trifluoromethyl)phenyl]azetidin-2-one (PubChem CID 64666853) has the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. Its IUPAC name is 4-methyl-4-[3-(trifluoromethyl)phenyl]azetidin-2-one.
| Compound Name | 4-methyl-4-[3-(trifluoromethyl)phenyl]azetidin-2-one |
|---|---|
| PubChem CID | 64666853 |
| Molecular Formula | C11H10F3NO |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 4-methyl-4-[3-(trifluoromethyl)phenyl]azetidin-2-one |
| SMILES | CC1(c2cccc(C(F)(F)F)c2)CC(=O)N1 |
| InChI | InChI=1S/C11H10F3NO/c1-10(6-9(16)15-10)7-3-2-4-8(5-7)11(12,13)14/h2-5H,6H2,1H3,(H,15,16) |
| InChIKey | LOWQXPULVQTDOM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |