C18H18N2O4S — CID 57496021
methyl 3-formyl-5-[2-(4-methyl-1,3-thiazol-2-yl)pyrrolidine-1-carbonyl]benzoate (PubChem CID 57496021) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is methyl 3-formyl-5-[2-(4-methyl-1,3-thiazol-2-yl)pyrrolidine-1-carbonyl]benzoate.
| Compound Name | methyl 3-formyl-5-[2-(4-methyl-1,3-thiazol-2-yl)pyrrolidine-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 57496021 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | methyl 3-formyl-5-[2-(4-methyl-1,3-thiazol-2-yl)pyrrolidine-1-carbonyl]benzoate |
| SMILES | COC(=O)c1cc(C=O)cc(C(=O)N2CCCC2c2nc(C)cs2)c1 |
| InChI | InChI=1S/C18H18N2O4S/c1-11-10-25-16(19-11)15-4-3-5-20(15)17(22)13-6-12(9-21)7-14(8-13)18(23)24-2/h6-10,15H,3-5H2,1-2H3 |
| InChIKey | ZAQHQWGDQFIYGS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|