C20H24N6O3S — CID 76551991
4-[2-(4-methyl-1,3-thiazol-2-yl)pyrrolidine-1-carbonyl]-6-(2-oxopiperidin-1-yl)pyridine-2-carbohydrazide (PubChem CID 76551991) has the molecular formula C20H24N6O3S and a molecular weight of 428.52 g/mol. Its IUPAC name is 4-[2-(4-methyl-1,3-thiazol-2-yl)pyrrolidine-1-carbonyl]-6-(2-oxopiperidin-1-yl)pyridine-2-carbohydrazide.
| Compound Name | 4-[2-(4-methyl-1,3-thiazol-2-yl)pyrrolidine-1-carbonyl]-6-(2-oxopiperidin-1-yl)pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 76551991 |
| Molecular Formula | C20H24N6O3S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 4-[2-(4-methyl-1,3-thiazol-2-yl)pyrrolidine-1-carbonyl]-6-(2-oxopiperidin-1-yl)pyridine-2-carbohydrazide |
| SMILES | Cc1csc(C2CCCN2C(=O)c2cc(C(=O)NN)nc(N3CCCCC3=O)c2)n1 |
| InChI | InChI=1S/C20H24N6O3S/c1-12-11-30-19(22-12)15-5-4-8-25(15)20(29)13-9-14(18(28)24-21)23-16(10-13)26-7-3-2-6-17(26)27/h9-11,15H,2-8,21H2,1H3,(H,24,28) |
| InChIKey | MNAKFYUNUQNSPP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|