C32H38N2O3 — CID 57496043
tert-butyl 2-[(2S)-2-(dibenzylamino)-3-phenylpropanoyl]pyrrolidine-1-carboxylate (PubChem CID 57496043) has the molecular formula C32H38N2O3 and a molecular weight of 498.67 g/mol. Its IUPAC name is tert-butyl 2-[(2S)-2-(dibenzylamino)-3-phenylpropanoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(2S)-2-(dibenzylamino)-3-phenylpropanoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57496043 |
| Molecular Formula | C32H38N2O3 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | tert-butyl 2-[(2S)-2-(dibenzylamino)-3-phenylpropanoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C32H38N2O3/c1-32(2,3)37-31(36)34-21-13-20-28(34)30(35)29(22-25-14-7-4-8-15-25)33(23-26-16-9-5-10-17-26)24-27-18-11-6-12-19-27/h4-12,14-19,28-29H,13,20-24H2,1-3H3/t28?,29-/m0/s1 |
| InChIKey | DLSKMQOFESNWID-XIJSCUBXSA-N |
| XLogP | 6.27 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |