C29H49NO4Si — CID 10577426
tert-butyl (2S)-2-[3-benzyl-4-tri(propan-2-yl)silyloxybutanoyl]pyrrolidine-1-carboxylate (PubChem CID 10577426) has the molecular formula C29H49NO4Si and a molecular weight of 503.80 g/mol. Its IUPAC name is tert-butyl (2S)-2-[3-benzyl-4-tri(propan-2-yl)silyloxybutanoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[3-benzyl-4-tri(propan-2-yl)silyloxybutanoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10577426 |
| Molecular Formula | C29H49NO4Si |
| Molecular Weight | 503.80 g/mol |
| Exact Mass | 503.34 |
| IUPAC Name | tert-butyl (2S)-2-[3-benzyl-4-tri(propan-2-yl)silyloxybutanoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)[Si](OCC(CC(=O)[C@@H]1CCCN1C(=O)OC(C)(C)C)Cc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H49NO4Si/c1-21(2)35(22(3)4,23(5)6)33-20-25(18-24-14-11-10-12-15-24)19-27(31)26-16-13-17-30(26)28(32)34-29(7,8)9/h10-12,14-15,21-23,25-26H,13,16-20H2,1-9H3/t25?,26-/m0/s1 |
| InChIKey | KILWFAOSZLPEOM-AMVUTOCUSA-N |
| XLogP | 7.40 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.80 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|