C23H30N6O4 — CID 57496318
propan-2-yl 4-[1-[4-(2-methoxyethylamino)phenyl]pyrazolo[5,4-d]pyrimidin-4-yl]oxypiperidine-1-carboxylate (PubChem CID 57496318) has the molecular formula C23H30N6O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is propan-2-yl 4-[1-[4-(2-methoxyethylamino)phenyl]pyrazolo[5,4-d]pyrimidin-4-yl]oxypiperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[1-[4-(2-methoxyethylamino)phenyl]pyrazolo[5,4-d]pyrimidin-4-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 57496318 |
| Molecular Formula | C23H30N6O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | propan-2-yl 4-[1-[4-(2-methoxyethylamino)phenyl]pyrazolo[5,4-d]pyrimidin-4-yl]oxypiperidine-1-carboxylate |
| SMILES | COCCNc1ccc(-n2ncc3c(OC4CCN(C(=O)OC(C)C)CC4)ncnc32)cc1 |
| InChI | InChI=1S/C23H30N6O4/c1-16(2)32-23(30)28-11-8-19(9-12-28)33-22-20-14-27-29(21(20)25-15-26-22)18-6-4-17(5-7-18)24-10-13-31-3/h4-7,14-16,19,24H,8-13H2,1-3H3 |
| InChIKey | YLTVGSFPBKGJCF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|