C26H36N6O4 — CID 71201468
propan-2-yl 4-[1-[4-[2-ethoxyethyl(methyl)amino]-2-methylphenyl]pyrazolo[5,4-d]pyrimidin-4-yl]oxypiperidine-1-carboxylate (PubChem CID 71201468) has the molecular formula C26H36N6O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is propan-2-yl 4-[1-[4-[2-ethoxyethyl(methyl)amino]-2-methylphenyl]pyrazolo[5,4-d]pyrimidin-4-yl]oxypiperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[1-[4-[2-ethoxyethyl(methyl)amino]-2-methylphenyl]pyrazolo[5,4-d]pyrimidin-4-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 71201468 |
| Molecular Formula | C26H36N6O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | propan-2-yl 4-[1-[4-[2-ethoxyethyl(methyl)amino]-2-methylphenyl]pyrazolo[5,4-d]pyrimidin-4-yl]oxypiperidine-1-carboxylate |
| SMILES | CCOCCN(C)c1ccc(-n2ncc3c(OC4CCN(C(=O)OC(C)C)CC4)ncnc32)c(C)c1 |
| InChI | InChI=1S/C26H36N6O4/c1-6-34-14-13-30(5)20-7-8-23(19(4)15-20)32-24-22(16-29-32)25(28-17-27-24)36-21-9-11-31(12-10-21)26(33)35-18(2)3/h7-8,15-18,21H,6,9-14H2,1-5H3 |
| InChIKey | KNQVABLMFUKNLB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 94.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|