C16H12N2O2 — CID 576025
7,12-dihydrophthalazino[2,3-b]phthalazine-5,14-dione (PubChem CID 576025) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is 7,12-dihydrophthalazino[2,3-b]phthalazine-5,14-dione.
| Compound Name | 7,12-dihydrophthalazino[2,3-b]phthalazine-5,14-dione |
|---|---|
| PubChem CID | 576025 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 7,12-dihydrophthalazino[2,3-b]phthalazine-5,14-dione |
| SMILES | O=c1c2ccccc2c(=O)n2n1Cc1ccccc1C2 |
| InChI | InChI=1S/C16H12N2O2/c19-15-13-7-3-4-8-14(13)16(20)18-10-12-6-2-1-5-11(12)9-17(15)18/h1-8H,9-10H2 |
| InChIKey | CBNXJVNLZZCZGU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |