C13H12F7NO — CID 576338
2,2,3,3,4,4,4-heptafluoro-N-(3-phenylpropyl)butanamide (PubChem CID 576338) has the molecular formula C13H12F7NO and a molecular weight of 331.23 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-(3-phenylpropyl)butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-(3-phenylpropyl)butanamide |
|---|---|
| PubChem CID | 576338 |
| Molecular Formula | C13H12F7NO |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-(3-phenylpropyl)butanamide |
| SMILES | O=C(NCCCc1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H12F7NO/c14-11(15,12(16,17)13(18,19)20)10(22)21-8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,21,22) |
| InChIKey | WSLOVKUTYAQMOA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|