C20H22N2O — CID 576538
4-hydroxy-3,5-dimethyl-2,6-diphenylpiperidine-4-carbonitrile (PubChem CID 576538) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 4-hydroxy-3,5-dimethyl-2,6-diphenylpiperidine-4-carbonitrile.
| Compound Name | 4-hydroxy-3,5-dimethyl-2,6-diphenylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 576538 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 4-hydroxy-3,5-dimethyl-2,6-diphenylpiperidine-4-carbonitrile |
| SMILES | CC1C(c2ccccc2)NC(c2ccccc2)C(C)C1(O)C#N |
| InChI | InChI=1S/C20H22N2O/c1-14-18(16-9-5-3-6-10-16)22-19(15(2)20(14,23)13-21)17-11-7-4-8-12-17/h3-12,14-15,18-19,22-23H,1-2H3 |
| InChIKey | HTJJHIYXGFLKJV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|