C10H18O4S2 — CID 576645
2-[(2-methyl-1,3-dithiolan-2-yl)methyl]oxane-3,4,5-triol (PubChem CID 576645) has the molecular formula C10H18O4S2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-dithiolan-2-yl)methyl]oxane-3,4,5-triol.
| Compound Name | 2-[(2-methyl-1,3-dithiolan-2-yl)methyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 576645 |
| Molecular Formula | C10H18O4S2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-[(2-methyl-1,3-dithiolan-2-yl)methyl]oxane-3,4,5-triol |
| SMILES | CC1(CC2OCC(O)C(O)C2O)SCCS1 |
| InChI | InChI=1S/C10H18O4S2/c1-10(15-2-3-16-10)4-7-9(13)8(12)6(11)5-14-7/h6-9,11-13H,2-5H2,1H3 |
| InChIKey | IFWRIRFWERJAGP-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |