About ethyl 2-methyl-1,3-dithiolane-2-carboxylate
ethyl 2-methyl-1,3-dithiolane-2-carboxylate (PubChem CID 576647) has the molecular formula C7H12O2S2
and a molecular weight of 192.30 g/mol. Its IUPAC name is ethyl 2-methyl-1,3-dithiolane-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-methyl-1,3-dithiolane-2-carboxylate |
| PubChem CID | 576647 |
| Molecular Formula | C7H12O2S2 |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | ethyl 2-methyl-1,3-dithiolane-2-carboxylate |
| SMILES | CCOC(=O)C1(C)SCCS1 |
| InChI | InChI=1S/C7H12O2S2/c1-3-9-6(8)7(2)10-4-5-11-7/h3-5H2,1-2H3 |
| InChIKey | WRTPGTZTMXTVQC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-methyl-1,3-dithiolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methyl-1,3-dithiolane-2-carboxylate?
The IUPAC name of ethyl 2-methyl-1,3-dithiolane-2-carboxylate (CID 576647) is ethyl 2-methyl-1,3-dithiolane-2-carboxylate.
What is the SMILES notation for ethyl 2-methyl-1,3-dithiolane-2-carboxylate?
The canonical SMILES for ethyl 2-methyl-1,3-dithiolane-2-carboxylate is CCOC(=O)C1(C)SCCS1.
What is the InChIKey of ethyl 2-methyl-1,3-dithiolane-2-carboxylate?
The InChIKey is WRTPGTZTMXTVQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2S2/c1-3-9-6(8)7(2)10-4-5-11-7/h3-5H2,1-2H3.
What are the key properties of ethyl 2-methyl-1,3-dithiolane-2-carboxylate?
ethyl 2-methyl-1,3-dithiolane-2-carboxylate has a molecular weight of 192.30 g/mol, XLogP of 1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methyl-1,3-dithiolane-2-carboxylate is sourced from PubChem (CID 576647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).