C26H31NO5 — CID 5771796
methyl 4-[(E)-1-[(4-methoxycarbonylbenzoyl)amino]-2-propylhex-2-enyl]benzoate (PubChem CID 5771796) has the molecular formula C26H31NO5 and a molecular weight of 437.50 g/mol. Its IUPAC name is methyl 4-[(E)-1-[(4-methoxycarbonylbenzoyl)amino]-2-propylhex-2-enyl]benzoate.
| Compound Name | methyl 4-[(E)-1-[(4-methoxycarbonylbenzoyl)amino]-2-propylhex-2-enyl]benzoate |
|---|---|
| PubChem CID | 5771796 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | methyl 4-[(E)-1-[(4-methoxycarbonylbenzoyl)amino]-2-propylhex-2-enyl]benzoate |
| SMILES | CCC/C=C(\CCC)/C(C1=CC=C(C=C1)C(=O)OC)NC(=O)C2=CC=C(C=C2)C(=O)OC |
| InChI | InChI=1S/C26H31NO5/c1-5-7-9-18(8-6-2)23(19-10-14-21(15-11-19)25(29)31-3)27-24(28)20-12-16-22(17-13-20)26(30)32-4/h9-17,23H,5-8H2,1-4H3,(H,27,28)/b18-9+ |
| InChIKey | NKJNKSSHBFOMDJ-GIJQJNRQSA-N |
| XLogP | 6.00 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | 643 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|