C24H45N5O3 — CID 57824315
(Z)-N-[4-[[(2S)-2,3-diaminopropanoyl]-[3-[[(Z)-hept-4-enoyl]amino]propyl]amino]butyl]hept-4-enamide (PubChem CID 57824315) has the molecular formula C24H45N5O3 and a molecular weight of 451.60 g/mol. Its IUPAC name is (Z)-N-[4-[[(2S)-2,3-diaminopropanoyl]-[3-[[(Z)-hept-4-enoyl]amino]propyl]amino]butyl]hept-4-enamide.
| Compound Name | (Z)-N-[4-[[(2S)-2,3-diaminopropanoyl]-[3-[[(Z)-hept-4-enoyl]amino]propyl]amino]butyl]hept-4-enamide |
|---|---|
| PubChem CID | 57824315 |
| Molecular Formula | C24H45N5O3 |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.35 |
| IUPAC Name | (Z)-N-[4-[[(2S)-2,3-diaminopropanoyl]-[3-[[(Z)-hept-4-enoyl]amino]propyl]amino]butyl]hept-4-enamide |
| SMILES | CC/C=C\CCC(=O)NCCCCN(CCCNC(=O)CC/C=C\CC)C(=O)[C@H](CN)N |
| InChI | InChI=1S/C24H45N5O3/c1-3-5-7-9-14-22(30)27-16-11-12-18-29(24(32)21(26)20-25)19-13-17-28-23(31)15-10-8-6-4-2/h5-8,21H,3-4,9-20,25-26H2,1-2H3,(H,27,30)(H,28,31)/b7-5-,8-6-/t21-/m0/s1 |
| InChIKey | KCEZVJOOXINYAU-WUEFALNCSA-N |
| XLogP | 1.00 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | 578 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|