C14H23NO3 — CID 57963570
tert-butyl (2R,6R)-2-ethenyl-6-ethyl-4-oxopiperidine-1-carboxylate (PubChem CID 57963570) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is tert-butyl (2R,6R)-2-ethenyl-6-ethyl-4-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,6R)-2-ethenyl-6-ethyl-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 57963570 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | tert-butyl (2R,6R)-2-ethenyl-6-ethyl-4-oxopiperidine-1-carboxylate |
| SMILES | CC[C@@H]1CC(=O)C[C@@H](N1C(=O)OC(C)(C)C)C=C |
| InChI | InChI=1S/C14H23NO3/c1-6-10-8-12(16)9-11(7-2)15(10)13(17)18-14(3,4)5/h6,10-11H,1,7-9H2,2-5H3/t10-,11+/m0/s1 |
| InChIKey | WMYNGXCOJAUCLI-WDEREUQCSA-N |
| XLogP | 2.20 |
| TPSA | 46.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | 343 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|