C18H23NO4 — CID 135062471
tert-butyl (2S,6R)-4-oxo-2-[(Z)-5-oxopent-1-en-3-ynyl]-6-prop-2-enylpiperidine-1-carboxylate (PubChem CID 135062471) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is tert-butyl (2S,6R)-4-oxo-2-[(Z)-5-oxopent-1-en-3-ynyl]-6-prop-2-enylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,6R)-4-oxo-2-[(Z)-5-oxopent-1-en-3-ynyl]-6-prop-2-enylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 135062471 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | tert-butyl (2S,6R)-4-oxo-2-[(Z)-5-oxopent-1-en-3-ynyl]-6-prop-2-enylpiperidine-1-carboxylate |
| SMILES | C=CC[C@@H]1CC(=O)C[C@@H](/C=C\C#CC=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H23NO4/c1-5-9-14-12-16(21)13-15(10-7-6-8-11-20)19(14)17(22)23-18(2,3)4/h5,7,10-11,14-15H,1,9,12-13H2,2-4H3/b10-7-/t14-,15-/m1/s1 |
| InChIKey | FISVTTCHGZCGNI-IKQZUGGXSA-N |
| XLogP | 2.66 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|