C33H42N6O6 — CID 58001188
tert-butyl N-[2-[[4-[[[3-(dimethylamino)-2,2-dimethylpropyl]-[(4-nitrophenyl)carbamoyl]amino]methyl]benzoyl]amino]phenyl]carbamate (PubChem CID 58001188) has the molecular formula C33H42N6O6 and a molecular weight of 618.74 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-[[[3-(dimethylamino)-2,2-dimethylpropyl]-[(4-nitrophenyl)carbamoyl]amino]methyl]benzoyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-[[[3-(dimethylamino)-2,2-dimethylpropyl]-[(4-nitrophenyl)carbamoyl]amino]methyl]benzoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 58001188 |
| Molecular Formula | C33H42N6O6 |
| Molecular Weight | 618.74 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | tert-butyl N-[2-[[4-[[[3-(dimethylamino)-2,2-dimethylpropyl]-[(4-nitrophenyl)carbamoyl]amino]methyl]benzoyl]amino]phenyl]carbamate |
| SMILES | CN(C)CC(C)(C)CN(Cc1ccc(C(=O)Nc2ccccc2NC(=O)OC(C)(C)C)cc1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H42N6O6/c1-32(2,3)45-31(42)36-28-11-9-8-10-27(28)35-29(40)24-14-12-23(13-15-24)20-38(22-33(4,5)21-37(6)7)30(41)34-25-16-18-26(19-17-25)39(43)44/h8-19H,20-22H2,1-7H3,(H,34,41)(H,35,40)(H,36,42) |
| InChIKey | IPOWXEMWSZDZKR-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.74 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|